C11H17NO — CID 89073728
3-cyclopentyloxycyclohexa-2,4-dien-1-amine (PubChem CID 89073728) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 3-cyclopentyloxycyclohexa-2,4-dien-1-amine.
| Compound Name | 3-cyclopentyloxycyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 89073728 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 3-cyclopentyloxycyclohexa-2,4-dien-1-amine |
| SMILES | NC1C=C(OC2CCCC2)C=CC1 |
| InChI | InChI=1S/C11H17NO/c12-9-4-3-7-11(8-9)13-10-5-1-2-6-10/h3,7-10H,1-2,4-6,12H2 |
| InChIKey | MPYXDGNETRIKCN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |