C12H19NO — CID 89073629
4-cyclohexyloxycyclohexa-2,4-dien-1-amine (PubChem CID 89073629) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 4-cyclohexyloxycyclohexa-2,4-dien-1-amine.
| Compound Name | 4-cyclohexyloxycyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 89073629 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 4-cyclohexyloxycyclohexa-2,4-dien-1-amine |
| SMILES | NC1C=CC(OC2CCCCC2)=CC1 |
| InChI | InChI=1S/C12H19NO/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h6,8-11H,1-5,7,13H2 |
| InChIKey | ABULCYUFOSQTMW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |