C11H17NO2 — CID 89073725
4-(oxan-4-yloxy)cyclohexa-2,4-dien-1-amine (PubChem CID 89073725) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 4-(oxan-4-yloxy)cyclohexa-2,4-dien-1-amine.
| Compound Name | 4-(oxan-4-yloxy)cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 89073725 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 4-(oxan-4-yloxy)cyclohexa-2,4-dien-1-amine |
| SMILES | NC1C=CC(OC2CCOCC2)=CC1 |
| InChI | InChI=1S/C11H17NO2/c12-9-1-3-10(4-2-9)14-11-5-7-13-8-6-11/h1,3-4,9,11H,2,5-8,12H2 |
| InChIKey | CYXUTHOKZFLSTB-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |