C10H19NO — CID 123371000
6-methoxy-N-methylocta-4,6-dien-1-amine (PubChem CID 123371000) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is 6-methoxy-N-methylocta-4,6-dien-1-amine.
| Compound Name | 6-methoxy-N-methylocta-4,6-dien-1-amine |
|---|---|
| PubChem CID | 123371000 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 6-methoxy-N-methylocta-4,6-dien-1-amine |
| SMILES | CC=C(C=CCCCNC)OC |
| InChI | InChI=1S/C10H19NO/c1-4-10(12-3)8-6-5-7-9-11-2/h4,6,8,11H,5,7,9H2,1-3H3 |
| InChIKey | OPXDRCGTXOYKSO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|