C10H19NO2 — CID 123422902
5,6-dimethoxy-N-methyl-3-methylidenehex-4-en-1-amine (PubChem CID 123422902) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 5,6-dimethoxy-N-methyl-3-methylidenehex-4-en-1-amine.
| Compound Name | 5,6-dimethoxy-N-methyl-3-methylidenehex-4-en-1-amine |
|---|---|
| PubChem CID | 123422902 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 5,6-dimethoxy-N-methyl-3-methylidenehex-4-en-1-amine |
| SMILES | C=C(C=C(COC)OC)CCNC |
| InChI | InChI=1S/C10H19NO2/c1-9(5-6-11-2)7-10(13-4)8-12-3/h7,11H,1,5-6,8H2,2-4H3 |
| InChIKey | OKBYBJZANDQOJY-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|