C10H15NO — CID 90818419
2-(3-methoxycyclohepta-1,3,6-trien-1-yl)ethanamine (PubChem CID 90818419) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 2-(3-methoxycyclohepta-1,3,6-trien-1-yl)ethanamine.
| Compound Name | 2-(3-methoxycyclohepta-1,3,6-trien-1-yl)ethanamine |
|---|---|
| PubChem CID | 90818419 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 2-(3-methoxycyclohepta-1,3,6-trien-1-yl)ethanamine |
| SMILES | COC1=CCC=CC(CCN)=C1 |
| InChI | InChI=1S/C10H15NO/c1-12-10-5-3-2-4-9(8-10)6-7-11/h2,4-5,8H,3,6-7,11H2,1H3 |
| InChIKey | AFFNZAWNGFIJTP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |