C13H23NO — CID 143115327
(3Z,5Z)-5-methoxy-N-methyl-3-[(Z)-prop-1-enyl]octa-3,5-dien-1-amine (PubChem CID 143115327) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is (3Z,5Z)-5-methoxy-N-methyl-3-[(Z)-prop-1-enyl]octa-3,5-dien-1-amine.
| Compound Name | (3Z,5Z)-5-methoxy-N-methyl-3-[(Z)-prop-1-enyl]octa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 143115327 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (3Z,5Z)-5-methoxy-N-methyl-3-[(Z)-prop-1-enyl]octa-3,5-dien-1-amine |
| SMILES | C/C=C\C(=C/C(=C/CC)OC)CCNC |
| InChI | InChI=1S/C13H23NO/c1-5-7-12(9-10-14-3)11-13(15-4)8-6-2/h5,7-8,11,14H,6,9-10H2,1-4H3/b7-5-,12-11+,13-8- |
| InChIKey | UNYRGDUBJMAXTP-WUSDISQPSA-N |
| XLogP | 3.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|