C10H15NO2 — CID 14811298
N-[(4-methoxycyclohexa-2,4-dien-1-yl)methyl]acetamide (PubChem CID 14811298) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is N-[(4-methoxycyclohexa-2,4-dien-1-yl)methyl]acetamide.
| Compound Name | N-[(4-methoxycyclohexa-2,4-dien-1-yl)methyl]acetamide |
|---|---|
| PubChem CID | 14811298 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | N-[(4-methoxycyclohexa-2,4-dien-1-yl)methyl]acetamide |
| SMILES | COC1=CCC(CNC(C)=O)C=C1 |
| InChI | InChI=1S/C10H15NO2/c1-8(12)11-7-9-3-5-10(13-2)6-4-9/h3,5-6,9H,4,7H2,1-2H3,(H,11,12) |
| InChIKey | KYWMDLNTBHFPGN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |