About ethane;ethene;(Z)-N-methyl-4-methylidenehept-5-enamide
ethane;ethene;(Z)-N-methyl-4-methylidenehept-5-enamide (PubChem CID 142368117) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is ethane;ethene;(Z)-N-methyl-4-methylidenehept-5-enamide.
Molecular Properties
| Compound Name | ethane;ethene;(Z)-N-methyl-4-methylidenehept-5-enamide |
| PubChem CID | 142368117 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | ethane;ethene;(Z)-N-methyl-4-methylidenehept-5-enamide |
| SMILES | C=C.C=C(/C=C\C)CCC(=O)NC.CC |
| InChI | InChI=1S/C9H15NO.C2H6.C2H4/c1-4-5-8(2)6-7-9(11)10-3;2*1-2/h4-5H,2,6-7H2,1,3H3,(H,10,11);1-2H3;1-2H2/b5-4-;; |
| InChIKey | UVMCHJCHLBXBSP-WNCVTPEDSA-N |
| XLogP | 3.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethene;(Z)-N-methyl-4-methylidenehept-5-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethene;(Z)-N-methyl-4-methylidenehept-5-enamide?
The IUPAC name of ethane;ethene;(Z)-N-methyl-4-methylidenehept-5-enamide (CID 142368117) is ethane;ethene;(Z)-N-methyl-4-methylidenehept-5-enamide.
What is the SMILES notation for ethane;ethene;(Z)-N-methyl-4-methylidenehept-5-enamide?
The canonical SMILES for ethane;ethene;(Z)-N-methyl-4-methylidenehept-5-enamide is C=C.C=C(/C=C\C)CCC(=O)NC.CC.
What is the InChIKey of ethane;ethene;(Z)-N-methyl-4-methylidenehept-5-enamide?
The InChIKey is UVMCHJCHLBXBSP-WNCVTPEDSA-N. The full InChI is InChI=1S/C9H15NO.C2H6.C2H4/c1-4-5-8(2)6-7-9(11)10-3;2*1-2/h4-5H,2,6-7H2,1,3H3,(H,10,11);1-2H3;1-2H2/b5-4-;;.
What are the key properties of ethane;ethene;(Z)-N-methyl-4-methylidenehept-5-enamide?
ethane;ethene;(Z)-N-methyl-4-methylidenehept-5-enamide has a molecular weight of 211.35 g/mol, XLogP of 3.47, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethene;(Z)-N-methyl-4-methylidenehept-5-enamide is sourced from PubChem (CID 142368117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).