C13H21NO — CID 90699990
N-methyl-4-prop-1-enylnona-4,6-dienamide (PubChem CID 90699990) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is N-methyl-4-prop-1-enylnona-4,6-dienamide.
| Compound Name | N-methyl-4-prop-1-enylnona-4,6-dienamide |
|---|---|
| PubChem CID | 90699990 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | N-methyl-4-prop-1-enylnona-4,6-dienamide |
| SMILES | CC=CC(=CC=CCC)CCC(=O)NC |
| InChI | InChI=1S/C13H21NO/c1-4-6-7-9-12(8-5-2)10-11-13(15)14-3/h5-9H,4,10-11H2,1-3H3,(H,14,15) |
| InChIKey | MDPRRGUEXMWXQG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|