C16H27NO2 — CID 144515523
N-[(2Z)-6-methoxy-2-methylocta-2,7-dienyl]hex-5-enamide (PubChem CID 144515523) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is N-[(2Z)-6-methoxy-2-methylocta-2,7-dienyl]hex-5-enamide.
| Compound Name | N-[(2Z)-6-methoxy-2-methylocta-2,7-dienyl]hex-5-enamide |
|---|---|
| PubChem CID | 144515523 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | N-[(2Z)-6-methoxy-2-methylocta-2,7-dienyl]hex-5-enamide |
| SMILES | C=CCCCC(=O)NC/C(C)=C\CCC(C=C)OC |
| InChI | InChI=1S/C16H27NO2/c1-5-7-8-12-16(18)17-13-14(3)10-9-11-15(6-2)19-4/h5-6,10,15H,1-2,7-9,11-13H2,3-4H3,(H,17,18)/b14-10- |
| InChIKey | OVVFAYYFYLQBNE-UVTDQMKNSA-N |
| XLogP | 3.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|