C16H27NO2 — CID 142948494
(7E,11S,12Z)-9-methoxy-11,13-dimethyl-1-azacyclotetradeca-7,12-dien-2-one (PubChem CID 142948494) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is (7E,11S,12Z)-9-methoxy-11,13-dimethyl-1-azacyclotetradeca-7,12-dien-2-one.
| Compound Name | (7E,11S,12Z)-9-methoxy-11,13-dimethyl-1-azacyclotetradeca-7,12-dien-2-one |
|---|---|
| PubChem CID | 142948494 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | (7E,11S,12Z)-9-methoxy-11,13-dimethyl-1-azacyclotetradeca-7,12-dien-2-one |
| SMILES | COC1/C=C/CCCCC(=O)NC/C(C)=C\[C@@H](C)C1 |
| InChI | InChI=1S/C16H27NO2/c1-13-10-14(2)12-17-16(18)9-7-5-4-6-8-15(11-13)19-3/h6,8,10,13,15H,4-5,7,9,11-12H2,1-3H3,(H,17,18)/b8-6+,14-10-/t13-,15?/m1/s1 |
| InChIKey | HMOCDINEIZMGKJ-DTPQHRCLSA-N |
| XLogP | 3.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|