C16H27NO3 — CID 67992691
(7E,10S,11R,12Z)-10-hydroxy-9-methoxy-11,13-dimethyl-1-azacyclotetradeca-7,12-dien-2-one (PubChem CID 67992691) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is (7E,10S,11R,12Z)-10-hydroxy-9-methoxy-11,13-dimethyl-1-azacyclotetradeca-7,12-dien-2-one.
| Compound Name | (7E,10S,11R,12Z)-10-hydroxy-9-methoxy-11,13-dimethyl-1-azacyclotetradeca-7,12-dien-2-one |
|---|---|
| PubChem CID | 67992691 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | (7E,10S,11R,12Z)-10-hydroxy-9-methoxy-11,13-dimethyl-1-azacyclotetradeca-7,12-dien-2-one |
| SMILES | COC1/C=C/CCCCC(=O)NC/C(C)=C\[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C16H27NO3/c1-12-10-13(2)16(19)14(20-3)8-6-4-5-7-9-15(18)17-11-12/h6,8,10,13-14,16,19H,4-5,7,9,11H2,1-3H3,(H,17,18)/b8-6+,12-10-/t13-,14?,16+/m1/s1 |
| InChIKey | IOJLFLBSAYDJAK-UBHFBUNMSA-N |
| XLogP | 2.19 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|