C17H29NO3 — CID 78044107
10-hydroxy-9-methoxy-1,11,13-trimethyl-1-azacyclotetradeca-7,12-dien-2-one (PubChem CID 78044107) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is 10-hydroxy-9-methoxy-1,11,13-trimethyl-1-azacyclotetradeca-7,12-dien-2-one.
| Compound Name | 10-hydroxy-9-methoxy-1,11,13-trimethyl-1-azacyclotetradeca-7,12-dien-2-one |
|---|---|
| PubChem CID | 78044107 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 10-hydroxy-9-methoxy-1,11,13-trimethyl-1-azacyclotetradeca-7,12-dien-2-one |
| SMILES | COC1C=CCCCCC(=O)N(C)CC(C)=CC(C)C1O |
| InChI | InChI=1S/C17H29NO3/c1-13-11-14(2)17(20)15(21-4)9-7-5-6-8-10-16(19)18(3)12-13/h7,9,11,14-15,17,20H,5-6,8,10,12H2,1-4H3 |
| InChIKey | IWUAEBUWJXQJBZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|