About 2-(6-methyl-2-azaspiro[3.3]heptan-2-yl)ethanamine;2-methylbutane
2-(6-methyl-2-azaspiro[3.3]heptan-2-yl)ethanamine;2-methylbutane (PubChem CID 144515654) has the molecular formula C14H30N2
and a molecular weight of 226.41 g/mol. Its IUPAC name is 2-(6-methyl-2-azaspiro[3.3]heptan-2-yl)ethanamine;2-methylbutane.
Molecular Properties
| Compound Name | 2-(6-methyl-2-azaspiro[3.3]heptan-2-yl)ethanamine;2-methylbutane |
| PubChem CID | 144515654 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | 2-(6-methyl-2-azaspiro[3.3]heptan-2-yl)ethanamine;2-methylbutane |
| SMILES | CC1CC2(C1)CN(CCN)C2.CCC(C)C |
| InChI | InChI=1S/C9H18N2.C5H12/c1-8-4-9(5-8)6-11(7-9)3-2-10;1-4-5(2)3/h8H,2-7,10H2,1H3;5H,4H2,1-3H3 |
| InChIKey | LWOYMTZEENLIBF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(6-methyl-2-azaspiro[3.3]heptan-2-yl)ethanamine;2-methylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-methyl-2-azaspiro[3.3]heptan-2-yl)ethanamine;2-methylbutane?
The IUPAC name of 2-(6-methyl-2-azaspiro[3.3]heptan-2-yl)ethanamine;2-methylbutane (CID 144515654) is 2-(6-methyl-2-azaspiro[3.3]heptan-2-yl)ethanamine;2-methylbutane.
What is the SMILES notation for 2-(6-methyl-2-azaspiro[3.3]heptan-2-yl)ethanamine;2-methylbutane?
The canonical SMILES for 2-(6-methyl-2-azaspiro[3.3]heptan-2-yl)ethanamine;2-methylbutane is CC1CC2(C1)CN(CCN)C2.CCC(C)C.
What is the InChIKey of 2-(6-methyl-2-azaspiro[3.3]heptan-2-yl)ethanamine;2-methylbutane?
The InChIKey is LWOYMTZEENLIBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2.C5H12/c1-8-4-9(5-8)6-11(7-9)3-2-10;1-4-5(2)3/h8H,2-7,10H2,1H3;5H,4H2,1-3H3.
What are the key properties of 2-(6-methyl-2-azaspiro[3.3]heptan-2-yl)ethanamine;2-methylbutane?
2-(6-methyl-2-azaspiro[3.3]heptan-2-yl)ethanamine;2-methylbutane has a molecular weight of 226.41 g/mol, XLogP of 2.73, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methyl-2-azaspiro[3.3]heptan-2-yl)ethanamine;2-methylbutane is sourced from PubChem (CID 144515654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).