C12H24N2O — CID 144515655
butane;6-methyl-2-azaspiro[3.3]heptane-2-carboxamide (PubChem CID 144515655) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is butane;6-methyl-2-azaspiro[3.3]heptane-2-carboxamide.
| Compound Name | butane;6-methyl-2-azaspiro[3.3]heptane-2-carboxamide |
|---|---|
| PubChem CID | 144515655 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | butane;6-methyl-2-azaspiro[3.3]heptane-2-carboxamide |
| SMILES | CC1CC2(C1)CN(C(N)=O)C2.CCCC |
| InChI | InChI=1S/C8H14N2O.C4H10/c1-6-2-8(3-6)4-10(5-8)7(9)11;1-3-4-2/h6H,2-5H2,1H3,(H2,9,11);3-4H2,1-2H3 |
| InChIKey | DDZSMTFEBFIBNF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |