C8H15N3O3S — CID 142458772
2-ethylsulfonyl-2,6-diazaspiro[3.3]heptane-6-carboxamide (PubChem CID 142458772) has the molecular formula C8H15N3O3S and a molecular weight of 233.29 g/mol. Its IUPAC name is 2-ethylsulfonyl-2,6-diazaspiro[3.3]heptane-6-carboxamide.
| Compound Name | 2-ethylsulfonyl-2,6-diazaspiro[3.3]heptane-6-carboxamide |
|---|---|
| PubChem CID | 142458772 |
| Molecular Formula | C8H15N3O3S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 2-ethylsulfonyl-2,6-diazaspiro[3.3]heptane-6-carboxamide |
| SMILES | CCS(=O)(=O)N1CC2(CN(C(N)=O)C2)C1 |
| InChI | InChI=1S/C8H15N3O3S/c1-2-15(13,14)11-5-8(6-11)3-10(4-8)7(9)12/h2-6H2,1H3,(H2,9,12) |
| InChIKey | VPQOTIMVNWQMQL-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |