C14H22N2O — CID 144515973
(3Z)-5-amino-3-(6-azaspiro[3.4]octan-6-ylmethyl)hexa-1,3,5-trien-2-ol (PubChem CID 144515973) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is (3Z)-5-amino-3-(6-azaspiro[3.4]octan-6-ylmethyl)hexa-1,3,5-trien-2-ol.
| Compound Name | (3Z)-5-amino-3-(6-azaspiro[3.4]octan-6-ylmethyl)hexa-1,3,5-trien-2-ol |
|---|---|
| PubChem CID | 144515973 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | (3Z)-5-amino-3-(6-azaspiro[3.4]octan-6-ylmethyl)hexa-1,3,5-trien-2-ol |
| SMILES | C=C(N)/C=C(/CN1CCC2(CCC2)C1)C(=C)O |
| InChI | InChI=1S/C14H22N2O/c1-11(15)8-13(12(2)17)9-16-7-6-14(10-16)4-3-5-14/h8,17H,1-7,9-10,15H2/b13-8- |
| InChIKey | IBOSAYGSXYPCAC-JYRVWZFOSA-N |
| XLogP | 2.33 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|