C9H17N3O2 — CID 163812899
2-(2-amino-2,7-diazaspiro[4.4]nonan-7-yl)acetic acid (PubChem CID 163812899) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-(2-amino-2,7-diazaspiro[4.4]nonan-7-yl)acetic acid.
| Compound Name | 2-(2-amino-2,7-diazaspiro[4.4]nonan-7-yl)acetic acid |
|---|---|
| PubChem CID | 163812899 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 2-(2-amino-2,7-diazaspiro[4.4]nonan-7-yl)acetic acid |
| SMILES | NN1CCC2(CCN(CC(=O)O)C2)C1 |
| InChI | InChI=1S/C9H17N3O2/c10-12-4-2-9(7-12)1-3-11(6-9)5-8(13)14/h1-7,10H2,(H,13,14) |
| InChIKey | NOUSMPHPOSIVAA-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|