C17H28N2O5 — CID 144516272
3-[(Z)-[amino-(4-propan-2-yloxyphenyl)methylidene]amino]oxy-3-oxopropanoic acid;ethane (PubChem CID 144516272) has the molecular formula C17H28N2O5 and a molecular weight of 340.42 g/mol. Its IUPAC name is 3-[(Z)-[amino-(4-propan-2-yloxyphenyl)methylidene]amino]oxy-3-oxopropanoic acid;ethane.
| Compound Name | 3-[(Z)-[amino-(4-propan-2-yloxyphenyl)methylidene]amino]oxy-3-oxopropanoic acid;ethane |
|---|---|
| PubChem CID | 144516272 |
| Molecular Formula | C17H28N2O5 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 3-[(Z)-[amino-(4-propan-2-yloxyphenyl)methylidene]amino]oxy-3-oxopropanoic acid;ethane |
| SMILES | CC.CC.CC(C)Oc1ccc(/C(N)=N/OC(=O)CC(=O)O)cc1 |
| InChI | InChI=1S/C13H16N2O5.2C2H6/c1-8(2)19-10-5-3-9(4-6-10)13(14)15-20-12(18)7-11(16)17;2*1-2/h3-6,8H,7H2,1-2H3,(H2,14,15)(H,16,17);2*1-2H3 |
| InChIKey | HAKIEPCFZHSLHZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|