C22H20N2O11 — CID 123229059
3-[1-[4-[4-[N-(2-carboxyacetyl)oxy-C-methylcarbonimidoyl]phenoxy]peroxyphenyl]ethylideneamino]oxy-3-oxopropanoic acid (PubChem CID 123229059) has the molecular formula C22H20N2O11 and a molecular weight of 488.41 g/mol. Its IUPAC name is 3-[1-[4-[4-[N-(2-carboxyacetyl)oxy-C-methylcarbonimidoyl]phenoxy]peroxyphenyl]ethylideneamino]oxy-3-oxopropanoic acid.
| Compound Name | 3-[1-[4-[4-[N-(2-carboxyacetyl)oxy-C-methylcarbonimidoyl]phenoxy]peroxyphenyl]ethylideneamino]oxy-3-oxopropanoic acid |
|---|---|
| PubChem CID | 123229059 |
| Molecular Formula | C22H20N2O11 |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 3-[1-[4-[4-[N-(2-carboxyacetyl)oxy-C-methylcarbonimidoyl]phenoxy]peroxyphenyl]ethylideneamino]oxy-3-oxopropanoic acid |
| SMILES | CC(=NOC(=O)CC(=O)O)c1ccc(OOOc2ccc(C(C)=NOC(=O)CC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C22H20N2O11/c1-13(23-31-21(29)11-19(25)26)15-3-7-17(8-4-15)33-35-34-18-9-5-16(6-10-18)14(2)24-32-22(30)12-20(27)28/h3-10H,11-12H2,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | CLLFBPMQAFNITH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 179.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|