C32H38N4O8 — CID 177408604
[4-[(E)-C-methyl-N-[6-[[(E)-1-[4-(2-methylprop-2-enoyloxy)phenyl]ethylideneamino]oxycarbonylamino]hexylcarbamoyloxy]carbonimidoyl]phenyl] 2-methylprop-2-enoate (PubChem CID 177408604) has the molecular formula C32H38N4O8 and a molecular weight of 606.68 g/mol. Its IUPAC name is [4-[(E)-C-methyl-N-[6-[[(E)-1-[4-(2-methylprop-2-enoyloxy)phenyl]ethylideneamino]oxycarbonylamino]hexylcarbamoyloxy]carbonimidoyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[(E)-C-methyl-N-[6-[[(E)-1-[4-(2-methylprop-2-enoyloxy)phenyl]ethylideneamino]oxycarbonylamino]hexylcarbamoyloxy]carbonimidoyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 177408604 |
| Molecular Formula | C32H38N4O8 |
| Molecular Weight | 606.68 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | [4-[(E)-C-methyl-N-[6-[[(E)-1-[4-(2-methylprop-2-enoyloxy)phenyl]ethylideneamino]oxycarbonylamino]hexylcarbamoyloxy]carbonimidoyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(/C(C)=N/OC(=O)NCCCCCCNC(=O)O/N=C(\C)c2ccc(OC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C32H38N4O8/c1-21(2)29(37)41-27-15-11-25(12-16-27)23(5)35-43-31(39)33-19-9-7-8-10-20-34-32(40)44-36-24(6)26-13-17-28(18-14-26)42-30(38)22(3)4/h11-18H,1,3,7-10,19-20H2,2,4-6H3,(H,33,39)(H,34,40)/b35-23+,36-24+ |
| InChIKey | CUCNERKSVNOGNK-VJTPSNAYSA-N |
| XLogP | 5.81 |
| TPSA | 153.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.68 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|