C9H7NO2S — CID 144516714
thieno[3,2-c]pyridin-2-yl acetate (PubChem CID 144516714) has the molecular formula C9H7NO2S and a molecular weight of 193.23 g/mol. Its IUPAC name is thieno[3,2-c]pyridin-2-yl acetate.
| Compound Name | thieno[3,2-c]pyridin-2-yl acetate |
|---|---|
| PubChem CID | 144516714 |
| Molecular Formula | C9H7NO2S |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.02 |
| IUPAC Name | thieno[3,2-c]pyridin-2-yl acetate |
| SMILES | CC(=O)Oc1cc2cnccc2s1 |
| InChI | InChI=1S/C9H7NO2S/c1-6(11)12-9-4-7-5-10-3-2-8(7)13-9/h2-5H,1H3 |
| InChIKey | KMHXJJBHZGBOML-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |