C13H20 — CID 14451679
6-butyl-4-methylidene-2,3,3a,5-tetrahydro-1H-pentalene (PubChem CID 14451679) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is 6-butyl-4-methylidene-2,3,3a,5-tetrahydro-1H-pentalene.
| Compound Name | 6-butyl-4-methylidene-2,3,3a,5-tetrahydro-1H-pentalene |
|---|---|
| PubChem CID | 14451679 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 6-butyl-4-methylidene-2,3,3a,5-tetrahydro-1H-pentalene |
| SMILES | C=C1CC(CCCC)=C2CCCC12 |
| InChI | InChI=1S/C13H20/c1-3-4-6-11-9-10(2)12-7-5-8-13(11)12/h12H,2-9H2,1H3 |
| InChIKey | DWSOJASNZYUOOI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|