About 2-methylpropane;(Z)-4-propylhept-4-en-2-yne
2-methylpropane;(Z)-4-propylhept-4-en-2-yne (PubChem CID 144516980) has the molecular formula C14H26
and a molecular weight of 194.36 g/mol. Its IUPAC name is 2-methylpropane;(Z)-4-propylhept-4-en-2-yne.
Molecular Properties
| Compound Name | 2-methylpropane;(Z)-4-propylhept-4-en-2-yne |
| PubChem CID | 144516980 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | 2-methylpropane;(Z)-4-propylhept-4-en-2-yne |
| SMILES | CC#C/C(=C\CC)CCC.CC(C)C |
| InChI | InChI=1S/C10H16.C4H10/c1-4-7-10(8-5-2)9-6-3;1-4(2)3/h7H,4-5,8H2,1-3H3;4H,1-3H3/b10-7-; |
| InChIKey | NIMGRSZAKVDBRG-VEZAGKLZSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropane;(Z)-4-propylhept-4-en-2-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropane;(Z)-4-propylhept-4-en-2-yne?
The IUPAC name of 2-methylpropane;(Z)-4-propylhept-4-en-2-yne (CID 144516980) is 2-methylpropane;(Z)-4-propylhept-4-en-2-yne.
What is the SMILES notation for 2-methylpropane;(Z)-4-propylhept-4-en-2-yne?
The canonical SMILES for 2-methylpropane;(Z)-4-propylhept-4-en-2-yne is CC#C/C(=C\CC)CCC.CC(C)C.
What is the InChIKey of 2-methylpropane;(Z)-4-propylhept-4-en-2-yne?
The InChIKey is NIMGRSZAKVDBRG-VEZAGKLZSA-N. The full InChI is InChI=1S/C10H16.C4H10/c1-4-7-10(8-5-2)9-6-3;1-4(2)3/h7H,4-5,8H2,1-3H3;4H,1-3H3/b10-7-;.
What are the key properties of 2-methylpropane;(Z)-4-propylhept-4-en-2-yne?
2-methylpropane;(Z)-4-propylhept-4-en-2-yne has a molecular weight of 194.36 g/mol, XLogP of 4.81, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane;(Z)-4-propylhept-4-en-2-yne is sourced from PubChem (CID 144516980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).