About 4-methylbenzoic acid;2-[2-(2-methylphenyl)ethyl]-1H-indene
4-methylbenzoic acid;2-[2-(2-methylphenyl)ethyl]-1H-indene (PubChem CID 144517127) has the molecular formula C26H26O2
and a molecular weight of 370.49 g/mol. Its IUPAC name is 4-methylbenzoic acid;2-[2-(2-methylphenyl)ethyl]-1H-indene.
Molecular Properties
| Compound Name | 4-methylbenzoic acid;2-[2-(2-methylphenyl)ethyl]-1H-indene |
| PubChem CID | 144517127 |
| Molecular Formula | C26H26O2 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 4-methylbenzoic acid;2-[2-(2-methylphenyl)ethyl]-1H-indene |
| SMILES | Cc1ccc(C(=O)O)cc1.Cc1ccccc1CCC1=Cc2ccccc2C1 |
| InChI | InChI=1S/C18H18.C8H8O2/c1-14-6-2-3-7-16(14)11-10-15-12-17-8-4-5-9-18(17)13-15;1-6-2-4-7(5-3-6)8(9)10/h2-9,12H,10-11,13H2,1H3;2-5H,1H3,(H,9,10) |
| InChIKey | ZSZZKBZSLUYMNT-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methylbenzoic acid;2-[2-(2-methylphenyl)ethyl]-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzoic acid;2-[2-(2-methylphenyl)ethyl]-1H-indene?
The IUPAC name of 4-methylbenzoic acid;2-[2-(2-methylphenyl)ethyl]-1H-indene (CID 144517127) is 4-methylbenzoic acid;2-[2-(2-methylphenyl)ethyl]-1H-indene.
What is the SMILES notation for 4-methylbenzoic acid;2-[2-(2-methylphenyl)ethyl]-1H-indene?
The canonical SMILES for 4-methylbenzoic acid;2-[2-(2-methylphenyl)ethyl]-1H-indene is Cc1ccc(C(=O)O)cc1.Cc1ccccc1CCC1=Cc2ccccc2C1.
What is the InChIKey of 4-methylbenzoic acid;2-[2-(2-methylphenyl)ethyl]-1H-indene?
The InChIKey is ZSZZKBZSLUYMNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18.C8H8O2/c1-14-6-2-3-7-16(14)11-10-15-12-17-8-4-5-9-18(17)13-15;1-6-2-4-7(5-3-6)8(9)10/h2-9,12H,10-11,13H2,1H3;2-5H,1H3,(H,9,10).
What are the key properties of 4-methylbenzoic acid;2-[2-(2-methylphenyl)ethyl]-1H-indene?
4-methylbenzoic acid;2-[2-(2-methylphenyl)ethyl]-1H-indene has a molecular weight of 370.49 g/mol, XLogP of 6.26, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzoic acid;2-[2-(2-methylphenyl)ethyl]-1H-indene is sourced from PubChem (CID 144517127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).