C20H37NO2 — CID 144517231
2,3-dimethylhexane;ethane;4-methyl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 144517231) has the molecular formula C20H37NO2 and a molecular weight of 323.52 g/mol. Its IUPAC name is 2,3-dimethylhexane;ethane;4-methyl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | 2,3-dimethylhexane;ethane;4-methyl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 144517231 |
| Molecular Formula | C20H37NO2 |
| Molecular Weight | 323.52 g/mol |
| Exact Mass | 323.28 |
| IUPAC Name | 2,3-dimethylhexane;ethane;4-methyl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CC.CCCC(C)C(C)C.CN1C(=O)C2C3CCC(C3)C2C1=O |
| InChI | InChI=1S/C10H13NO2.C8H18.C2H6/c1-11-9(12)7-5-2-3-6(4-5)8(7)10(11)13;1-5-6-8(4)7(2)3;1-2/h5-8H,2-4H2,1H3;7-8H,5-6H2,1-4H3;1-2H3 |
| InChIKey | IRNGVDPKOYISHF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|