C14H18NO4- — CID 11880216
(2R)-2-[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-methylbutanoate (PubChem CID 11880216) has the molecular formula C14H18NO4- and a molecular weight of 264.30 g/mol. Its IUPAC name is (2R)-2-[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-methylbutanoate.
| Compound Name | (2R)-2-[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-methylbutanoate |
|---|---|
| PubChem CID | 11880216 |
| Molecular Formula | C14H18NO4- |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (2R)-2-[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-methylbutanoate |
| SMILES | CC(C)[C@H](C(=O)[O-])N1C(=O)[C@@H]2[C@@H]3CC[C@@H](C3)[C@@H]2C1=O |
| InChI | InChI=1S/C14H19NO4/c1-6(2)11(14(18)19)15-12(16)9-7-3-4-8(5-7)10(9)13(15)17/h6-11H,3-5H2,1-2H3,(H,18,19)/p-1/t7-,8+,9-,10+,11-/m1/s1 |
| InChIKey | MNKSUDDNUOWWMB-NZHYYXIDSA-M |
| XLogP | -0.21 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|