C24H30N2O5 — CID 21175044
[2-(2,3-dimethylanilino)-2-oxoethyl] (2R)-2-[(1S,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-methylbutanoate (PubChem CID 21175044) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is [2-(2,3-dimethylanilino)-2-oxoethyl] (2R)-2-[(1S,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-methylbutanoate.
| Compound Name | [2-(2,3-dimethylanilino)-2-oxoethyl] (2R)-2-[(1S,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-methylbutanoate |
|---|---|
| PubChem CID | 21175044 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | [2-(2,3-dimethylanilino)-2-oxoethyl] (2R)-2-[(1S,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-methylbutanoate |
| SMILES | Cc1cccc(NC(=O)COC(=O)[C@@H](C(C)C)N2C(=O)[C@H]3[C@H]4CC[C@@H](C4)[C@@H]3C2=O)c1C |
| InChI | InChI=1S/C24H30N2O5/c1-12(2)21(26-22(28)19-15-8-9-16(10-15)20(19)23(26)29)24(30)31-11-18(27)25-17-7-5-6-13(3)14(17)4/h5-7,12,15-16,19-21H,8-11H2,1-4H3,(H,25,27)/t15-,16-,19-,20-,21+/m0/s1 |
| InChIKey | UHVHIBCOKNYCIX-JPKZGUTDSA-N |
| XLogP | 2.84 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|