C24H29NO5 — CID 19181185
[2-(2,5-dimethylphenyl)-2-oxoethyl] (2S)-2-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-methylbutanoate (PubChem CID 19181185) has the molecular formula C24H29NO5 and a molecular weight of 411.50 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)-2-oxoethyl] (2S)-2-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-methylbutanoate.
| Compound Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] (2S)-2-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-methylbutanoate |
|---|---|
| PubChem CID | 19181185 |
| Molecular Formula | C24H29NO5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] (2S)-2-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-methylbutanoate |
| SMILES | Cc1ccc(C)c(C(=O)COC(=O)[C@H](C(C)C)N2C(=O)[C@@H]3[C@@H]4CC[C@H](C4)[C@@H]3C2=O)c1 |
| InChI | InChI=1S/C24H29NO5/c1-12(2)21(24(29)30-11-18(26)17-9-13(3)5-6-14(17)4)25-22(27)19-15-7-8-16(10-15)20(19)23(25)28/h5-6,9,12,15-16,19-21H,7-8,10-11H2,1-4H3/t15-,16-,19-,20+,21+/m1/s1 |
| InChIKey | LFVFIRCVBDCTAY-GQFKRECVSA-N |
| XLogP | 3.09 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|