C33H31NO5 — CID 7122012
[2-(2,5-dimethylphenyl)-2-oxoethyl] (2S)-2-[(15R,19R)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]-3-methylbutanoate (PubChem CID 7122012) has the molecular formula C33H31NO5 and a molecular weight of 521.61 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)-2-oxoethyl] (2S)-2-[(15R,19R)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]-3-methylbutanoate.
| Compound Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] (2S)-2-[(15R,19R)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]-3-methylbutanoate |
|---|---|
| PubChem CID | 7122012 |
| Molecular Formula | C33H31NO5 |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] (2S)-2-[(15R,19R)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]-3-methylbutanoate |
| SMILES | Cc1ccc(C)c(C(=O)COC(=O)[C@H](C(C)C)N2C(=O)[C@@H]3C4c5ccccc5C(c5ccccc54)[C@H]3C2=O)c1 |
| InChI | InChI=1S/C33H31NO5/c1-17(2)30(33(38)39-16-25(35)24-15-18(3)13-14-19(24)4)34-31(36)28-26-20-9-5-6-10-21(20)27(29(28)32(34)37)23-12-8-7-11-22(23)26/h5-15,17,26-30H,16H2,1-4H3/t26?,27?,28-,29-,30+/m1/s1 |
| InChIKey | LIHGUQHVXVXRJZ-PAYUHHOPSA-N |
| XLogP | 4.95 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|