C34H36N2O7 — CID 3121324
[2-(2,5-dimethylphenyl)-2-oxoethyl] 2,6-bis(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)hexanoate (PubChem CID 3121324) has the molecular formula C34H36N2O7 and a molecular weight of 584.67 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)-2-oxoethyl] 2,6-bis(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)hexanoate.
| Compound Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 2,6-bis(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)hexanoate |
|---|---|
| PubChem CID | 3121324 |
| Molecular Formula | C34H36N2O7 |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.25 |
| IUPAC Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 2,6-bis(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)hexanoate |
| SMILES | Cc1ccc(C)c(C(=O)COC(=O)C(CCCCN2C(=O)C3C4C=CC(C4)C3C2=O)N2C(=O)C3C4C=CC(C4)C3C2=O)c1 |
| InChI | InChI=1S/C34H36N2O7/c1-17-6-7-18(2)23(13-17)25(37)16-43-34(42)24(36-32(40)28-21-10-11-22(15-21)29(28)33(36)41)5-3-4-12-35-30(38)26-19-8-9-20(14-19)27(26)31(35)39/h6-11,13,19-22,24,26-29H,3-5,12,14-16H2,1-2H3 |
| InChIKey | UXLKJXVIKDYIOP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|