C20H36O3 — CID 144517640
1-[3,5-di(propan-2-yl)cyclohexa-1,3-dien-1-yl]ethanone;1-propoxypropan-1-ol (PubChem CID 144517640) has the molecular formula C20H36O3 and a molecular weight of 324.51 g/mol. Its IUPAC name is 1-[3,5-di(propan-2-yl)cyclohexa-1,3-dien-1-yl]ethanone;1-propoxypropan-1-ol.
| Compound Name | 1-[3,5-di(propan-2-yl)cyclohexa-1,3-dien-1-yl]ethanone;1-propoxypropan-1-ol |
|---|---|
| PubChem CID | 144517640 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | 1-[3,5-di(propan-2-yl)cyclohexa-1,3-dien-1-yl]ethanone;1-propoxypropan-1-ol |
| SMILES | CC(=O)C1=CC(C(C)C)=CC(C(C)C)C1.CCCOC(O)CC |
| InChI | InChI=1S/C14H22O.C6H14O2/c1-9(2)12-6-13(10(3)4)8-14(7-12)11(5)15;1-3-5-8-6(7)4-2/h6-7,9-10,13H,8H2,1-5H3;6-7H,3-5H2,1-2H3 |
| InChIKey | SXXNXDUBCUZPBT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|