C24H38O3 — CID 90877865
(2Z,4Z)-6-[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]-3-methyl-1-(4-methylcyclohexa-1,3-dien-1-yl)-2-propylocta-2,4-dien-1-one (PubChem CID 90877865) has the molecular formula C24H38O3 and a molecular weight of 374.57 g/mol. Its IUPAC name is (2Z,4Z)-6-[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]-3-methyl-1-(4-methylcyclohexa-1,3-dien-1-yl)-2-propylocta-2,4-dien-1-one.
| Compound Name | (2Z,4Z)-6-[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]-3-methyl-1-(4-methylcyclohexa-1,3-dien-1-yl)-2-propylocta-2,4-dien-1-one |
|---|---|
| PubChem CID | 90877865 |
| Molecular Formula | C24H38O3 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | (2Z,4Z)-6-[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]-3-methyl-1-(4-methylcyclohexa-1,3-dien-1-yl)-2-propylocta-2,4-dien-1-one |
| SMILES | CCC/C(C(=O)C1=CC=C(C)CC1)=C(C)/C=C\C(CC)C(O)OC(C)(C)C |
| InChI | InChI=1S/C24H38O3/c1-8-10-21(22(25)20-14-11-17(3)12-15-20)18(4)13-16-19(9-2)23(26)27-24(5,6)7/h11,13-14,16,19,23,26H,8-10,12,15H2,1-7H3/b16-13-,21-18- |
| InChIKey | XHYJWZMCUZVGLY-JIZUXXPMSA-N |
| XLogP | 6.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|