C10H12F6O2 — CID 144517974
1,1,1,3,3,3-hexafluoropropan-2-yl 2-ethyl-2-methylbut-3-enoate (PubChem CID 144517974) has the molecular formula C10H12F6O2 and a molecular weight of 278.19 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2-ethyl-2-methylbut-3-enoate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-ethyl-2-methylbut-3-enoate |
|---|---|
| PubChem CID | 144517974 |
| Molecular Formula | C10H12F6O2 |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-ethyl-2-methylbut-3-enoate |
| SMILES | C=CC(C)(CC)C(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H12F6O2/c1-4-8(3,5-2)7(17)18-6(9(11,12)13)10(14,15)16/h4,6H,1,5H2,2-3H3 |
| InChIKey | BLLZKSBVABLNBI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|