C22H45NO4 — CID 144518486
N-[(5,5-dimethyloxan-2-yl)methyl]formamide;(2R,3R)-6-ethyl-2,3-dimethyloxane;1-methoxypropane (PubChem CID 144518486) has the molecular formula C22H45NO4 and a molecular weight of 387.61 g/mol. Its IUPAC name is N-[(5,5-dimethyloxan-2-yl)methyl]formamide;(2R,3R)-6-ethyl-2,3-dimethyloxane;1-methoxypropane.
| Compound Name | N-[(5,5-dimethyloxan-2-yl)methyl]formamide;(2R,3R)-6-ethyl-2,3-dimethyloxane;1-methoxypropane |
|---|---|
| PubChem CID | 144518486 |
| Molecular Formula | C22H45NO4 |
| Molecular Weight | 387.61 g/mol |
| Exact Mass | 387.33 |
| IUPAC Name | N-[(5,5-dimethyloxan-2-yl)methyl]formamide;(2R,3R)-6-ethyl-2,3-dimethyloxane;1-methoxypropane |
| SMILES | CC1(C)CCC(CNC=O)OC1.CCC1CC[C@@H](C)[C@@H](C)O1.CCCOC |
| InChI | InChI=1S/C9H17NO2.C9H18O.C4H10O/c1-9(2)4-3-8(12-6-9)5-10-7-11;1-4-9-6-5-7(2)8(3)10-9;1-3-4-5-2/h7-8H,3-6H2,1-2H3,(H,10,11);7-9H,4-6H2,1-3H3;3-4H2,1-2H3/t;7-,8-,9?;/m.1./s1 |
| InChIKey | BDBSEYLDHMTVMC-FWJFWDFRSA-N |
| XLogP | 4.58 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.61 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|