C37H60N2O7S2 — CID 144519365
[8-[2-[4-[4-[6,8-bis(sulfanyl)octanoylamino]butylcarbamoyloxy]-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate (PubChem CID 144519365) has the molecular formula C37H60N2O7S2 and a molecular weight of 709.03 g/mol. Its IUPAC name is [8-[2-[4-[4-[6,8-bis(sulfanyl)octanoylamino]butylcarbamoyloxy]-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate.
| Compound Name | [8-[2-[4-[4-[6,8-bis(sulfanyl)octanoylamino]butylcarbamoyloxy]-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 144519365 |
| Molecular Formula | C37H60N2O7S2 |
| Molecular Weight | 709.03 g/mol |
| Exact Mass | 708.38 |
| IUPAC Name | [8-[2-[4-[4-[6,8-bis(sulfanyl)octanoylamino]butylcarbamoyloxy]-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1CC(C)C=C2C=CC(C)C(CCC3CC(OC(=O)NCCCCNC(=O)CCCCC(S)CCS)CC(=O)O3)C21 |
| InChI | InChI=1S/C37H60N2O7S2/c1-5-25(3)36(42)46-32-21-24(2)20-27-13-12-26(4)31(35(27)32)15-14-28-22-29(23-34(41)44-28)45-37(43)39-18-9-8-17-38-33(40)11-7-6-10-30(48)16-19-47/h12-13,20,24-26,28-32,35,47-48H,5-11,14-19,21-23H2,1-4H3,(H,38,40)(H,39,43) |
| InChIKey | OIOGOTDUPYTEPC-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.03 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|