C17H34O2 — CID 144520878
(3-ethyl-2,3-dimethyldecan-2-yl) propanoate (PubChem CID 144520878) has the molecular formula C17H34O2 and a molecular weight of 270.46 g/mol. Its IUPAC name is (3-ethyl-2,3-dimethyldecan-2-yl) propanoate.
| Compound Name | (3-ethyl-2,3-dimethyldecan-2-yl) propanoate |
|---|---|
| PubChem CID | 144520878 |
| Molecular Formula | C17H34O2 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.26 |
| IUPAC Name | (3-ethyl-2,3-dimethyldecan-2-yl) propanoate |
| SMILES | CCCCCCCC(C)(CC)C(C)(C)OC(=O)CC |
| InChI | InChI=1S/C17H34O2/c1-7-10-11-12-13-14-17(6,9-3)16(4,5)19-15(18)8-2/h7-14H2,1-6H3 |
| InChIKey | KCKNJNBPGBDYFF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|