About 4-formylnonan-4-yl propanoate
4-formylnonan-4-yl propanoate (PubChem CID 173379804) has the molecular formula C13H24O3
and a molecular weight of 228.33 g/mol. Its IUPAC name is 4-formylnonan-4-yl propanoate.
Molecular Properties
| Compound Name | 4-formylnonan-4-yl propanoate |
| PubChem CID | 173379804 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 4-formylnonan-4-yl propanoate |
| SMILES | CCCCCC(C=O)(CCC)OC(=O)CC |
| InChI | InChI=1S/C13H24O3/c1-4-7-8-10-13(11-14,9-5-2)16-12(15)6-3/h11H,4-10H2,1-3H3 |
| InChIKey | QWEAYHQUPWNLQR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-formylnonan-4-yl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-formylnonan-4-yl propanoate?
The IUPAC name of 4-formylnonan-4-yl propanoate (CID 173379804) is 4-formylnonan-4-yl propanoate.
What is the SMILES notation for 4-formylnonan-4-yl propanoate?
The canonical SMILES for 4-formylnonan-4-yl propanoate is CCCCCC(C=O)(CCC)OC(=O)CC.
What is the InChIKey of 4-formylnonan-4-yl propanoate?
The InChIKey is QWEAYHQUPWNLQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O3/c1-4-7-8-10-13(11-14,9-5-2)16-12(15)6-3/h11H,4-10H2,1-3H3.
What are the key properties of 4-formylnonan-4-yl propanoate?
4-formylnonan-4-yl propanoate has a molecular weight of 228.33 g/mol, XLogP of 3.26, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-formylnonan-4-yl propanoate is sourced from PubChem (CID 173379804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).