C15H18N2O3S2 — CID 144520992
[(E)-[(Z,2E)-1-(5,6-dihydro-1,3-benzothiazol-2-yl)-2-ethylidenepent-3-enylidene]amino] methanesulfonate (PubChem CID 144520992) has the molecular formula C15H18N2O3S2 and a molecular weight of 338.45 g/mol. Its IUPAC name is [(E)-[(Z,2E)-1-(5,6-dihydro-1,3-benzothiazol-2-yl)-2-ethylidenepent-3-enylidene]amino] methanesulfonate.
| Compound Name | [(E)-[(Z,2E)-1-(5,6-dihydro-1,3-benzothiazol-2-yl)-2-ethylidenepent-3-enylidene]amino] methanesulfonate |
|---|---|
| PubChem CID | 144520992 |
| Molecular Formula | C15H18N2O3S2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | [(E)-[(Z,2E)-1-(5,6-dihydro-1,3-benzothiazol-2-yl)-2-ethylidenepent-3-enylidene]amino] methanesulfonate |
| SMILES | C/C=C\C(=C/C)\C(=N/OS(C)(=O)=O)c1nc2c(s1)=CCCC=2 |
| InChI | InChI=1S/C15H18N2O3S2/c1-4-8-11(5-2)14(17-20-22(3,18)19)15-16-12-9-6-7-10-13(12)21-15/h4-5,8-10H,6-7H2,1-3H3/b8-4-,11-5+,17-14+ |
| InChIKey | APLBMBANOAZWAT-WFQGTQBFSA-N |
| XLogP | 1.70 |
| TPSA | 68.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|