C6H9BrN2 — CID 144521368
(E)-2-bromo-N-ethyl-N'-methylideneprop-2-ene-1,3-diimine (PubChem CID 144521368) has the molecular formula C6H9BrN2 and a molecular weight of 189.06 g/mol. Its IUPAC name is (E)-2-bromo-N-ethyl-N'-methylideneprop-2-ene-1,3-diimine.
| Compound Name | (E)-2-bromo-N-ethyl-N'-methylideneprop-2-ene-1,3-diimine |
|---|---|
| PubChem CID | 144521368 |
| Molecular Formula | C6H9BrN2 |
| Molecular Weight | 189.06 g/mol |
| Exact Mass | 187.99 |
| IUPAC Name | (E)-2-bromo-N-ethyl-N'-methylideneprop-2-ene-1,3-diimine |
| SMILES | C=N/C=C(Br)\C=N\CC |
| InChI | InChI=1S/C6H9BrN2/c1-3-9-5-6(7)4-8-2/h4-5H,2-3H2,1H3/b6-4+,9-5+ |
| InChIKey | FQMRZQXTGHQDID-REZHQCRGSA-N |
| XLogP | 2.01 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.06 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|