C5H10BrN3 — CID 58368886
(E,3E)-3-(1-aminoethylimino)-2-bromoprop-1-en-1-amine (PubChem CID 58368886) has the molecular formula C5H10BrN3 and a molecular weight of 192.06 g/mol. Its IUPAC name is (E,3E)-3-(1-aminoethylimino)-2-bromoprop-1-en-1-amine.
| Compound Name | (E,3E)-3-(1-aminoethylimino)-2-bromoprop-1-en-1-amine |
|---|---|
| PubChem CID | 58368886 |
| Molecular Formula | C5H10BrN3 |
| Molecular Weight | 192.06 g/mol |
| Exact Mass | 191.01 |
| IUPAC Name | (E,3E)-3-(1-aminoethylimino)-2-bromoprop-1-en-1-amine |
| SMILES | CC(N)/N=C/C(Br)=C\N |
| InChI | InChI=1S/C5H10BrN3/c1-4(8)9-3-5(6)2-7/h2-4H,7-8H2,1H3/b5-2+,9-3+ |
| InChIKey | VOKNWXVPKNFVMJ-SKRMJIETSA-N |
| XLogP | 0.56 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.06 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|