C32H35NO2 — CID 144523614
N-[(2,4-dimethylphenyl)-phenylmethyl]-2-[4-[(2E,4Z)-2-prop-1-en-2-ylhexa-2,4-dienoxy]phenyl]acetamide (PubChem CID 144523614) has the molecular formula C32H35NO2 and a molecular weight of 465.64 g/mol. Its IUPAC name is N-[(2,4-dimethylphenyl)-phenylmethyl]-2-[4-[(2E,4Z)-2-prop-1-en-2-ylhexa-2,4-dienoxy]phenyl]acetamide.
| Compound Name | N-[(2,4-dimethylphenyl)-phenylmethyl]-2-[4-[(2E,4Z)-2-prop-1-en-2-ylhexa-2,4-dienoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 144523614 |
| Molecular Formula | C32H35NO2 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | N-[(2,4-dimethylphenyl)-phenylmethyl]-2-[4-[(2E,4Z)-2-prop-1-en-2-ylhexa-2,4-dienoxy]phenyl]acetamide |
| SMILES | C=C(C)/C(=C\C=C/C)COc1ccc(CC(=O)NC(c2ccccc2)c2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C32H35NO2/c1-6-7-11-28(23(2)3)22-35-29-17-15-26(16-18-29)21-31(34)33-32(27-12-9-8-10-13-27)30-19-14-24(4)20-25(30)5/h6-20,32H,2,21-22H2,1,3-5H3,(H,33,34)/b7-6-,28-11- |
| InChIKey | MXCUYVGCQYSORF-IZQCKKALSA-N |
| XLogP | 7.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|