About ethane;N-ethylidene-N'-methanimidoylmethanimidamide;prop-1-ene
ethane;N-ethylidene-N'-methanimidoylmethanimidamide;prop-1-ene (PubChem CID 144524018) has the molecular formula C9H19N3
and a molecular weight of 169.27 g/mol. Its IUPAC name is ethane;N-ethylidene-N'-methanimidoylmethanimidamide;prop-1-ene.
Molecular Properties
| Compound Name | ethane;N-ethylidene-N'-methanimidoylmethanimidamide;prop-1-ene |
| PubChem CID | 144524018 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | ethane;N-ethylidene-N'-methanimidoylmethanimidamide;prop-1-ene |
| SMILES | C=CC.CC.[H]/N=C/N=C/N=C/C |
| InChI | InChI=1S/C4H7N3.C3H6.C2H6/c1-2-6-4-7-3-5;1-3-2;1-2/h2-5H,1H3;3H,1H2,2H3;1-2H3/b5-3+,6-2+,7-4+;; |
| InChIKey | YZUDKFFRBRXBLH-YBRJKBJZSA-N |
| XLogP | 2.93 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-ethylidene-N'-methanimidoylmethanimidamide;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-ethylidene-N'-methanimidoylmethanimidamide;prop-1-ene?
The IUPAC name of ethane;N-ethylidene-N'-methanimidoylmethanimidamide;prop-1-ene (CID 144524018) is ethane;N-ethylidene-N'-methanimidoylmethanimidamide;prop-1-ene.
What is the SMILES notation for ethane;N-ethylidene-N'-methanimidoylmethanimidamide;prop-1-ene?
The canonical SMILES for ethane;N-ethylidene-N'-methanimidoylmethanimidamide;prop-1-ene is C=CC.CC.[H]/N=C/N=C/N=C/C.
What is the InChIKey of ethane;N-ethylidene-N'-methanimidoylmethanimidamide;prop-1-ene?
The InChIKey is YZUDKFFRBRXBLH-YBRJKBJZSA-N. The full InChI is InChI=1S/C4H7N3.C3H6.C2H6/c1-2-6-4-7-3-5;1-3-2;1-2/h2-5H,1H3;3H,1H2,2H3;1-2H3/b5-3+,6-2+,7-4+;;.
What are the key properties of ethane;N-ethylidene-N'-methanimidoylmethanimidamide;prop-1-ene?
ethane;N-ethylidene-N'-methanimidoylmethanimidamide;prop-1-ene has a molecular weight of 169.27 g/mol, XLogP of 2.93, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-ethylidene-N'-methanimidoylmethanimidamide;prop-1-ene is sourced from PubChem (CID 144524018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).