C22H23F3N4O2S — CID 144525497
N'-[2-(1-oxo-3,5-dihydro-2H-1λ4,4-benzothiazepin-4-yl)-6-(trifluoromethoxy)quinolin-4-yl]propane-1,3-diamine (PubChem CID 144525497) has the molecular formula C22H23F3N4O2S and a molecular weight of 464.51 g/mol. Its IUPAC name is N'-[2-(1-oxo-3,5-dihydro-2H-1λ4,4-benzothiazepin-4-yl)-6-(trifluoromethoxy)quinolin-4-yl]propane-1,3-diamine.
| Compound Name | N'-[2-(1-oxo-3,5-dihydro-2H-1λ4,4-benzothiazepin-4-yl)-6-(trifluoromethoxy)quinolin-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 144525497 |
| Molecular Formula | C22H23F3N4O2S |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | N'-[2-(1-oxo-3,5-dihydro-2H-1λ4,4-benzothiazepin-4-yl)-6-(trifluoromethoxy)quinolin-4-yl]propane-1,3-diamine |
| SMILES | NCCCNc1cc(N2CCS(=O)c3ccccc3C2)nc2ccc(OC(F)(F)F)cc12 |
| InChI | InChI=1S/C22H23F3N4O2S/c23-22(24,25)31-16-6-7-18-17(12-16)19(27-9-3-8-26)13-21(28-18)29-10-11-32(30)20-5-2-1-4-15(20)14-29/h1-2,4-7,12-13H,3,8-11,14,26H2,(H,27,28) |
| InChIKey | ODMDFCKCNZANSJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|