C28H37N3O3 — CID 144525774
but-2-ene;ethane;6-[(E)-3-oxo-3-(4-phenoxypiperidin-1-yl)prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one (PubChem CID 144525774) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is but-2-ene;ethane;6-[(E)-3-oxo-3-(4-phenoxypiperidin-1-yl)prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one.
| Compound Name | but-2-ene;ethane;6-[(E)-3-oxo-3-(4-phenoxypiperidin-1-yl)prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 144525774 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | but-2-ene;ethane;6-[(E)-3-oxo-3-(4-phenoxypiperidin-1-yl)prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| SMILES | CC.CC=CC.O=C1CCc2cc(/C=C/C(=O)N3CCC(Oc4ccccc4)CC3)cnc2N1 |
| InChI | InChI=1S/C22H23N3O3.C4H8.C2H6/c26-20-8-7-17-14-16(15-23-22(17)24-20)6-9-21(27)25-12-10-19(11-13-25)28-18-4-2-1-3-5-18;1-3-4-2;1-2/h1-6,9,14-15,19H,7-8,10-13H2,(H,23,24,26);3-4H,1-2H3;1-2H3/b9-6+;; |
| InChIKey | STKNRCMLLNJWAJ-SWSRPJROSA-N |
| XLogP | 5.66 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|