C18H28O — CID 144526488
1-tert-butyl-4-[[(1S)-2-methylcyclohexyl]methoxy]benzene (PubChem CID 144526488) has the molecular formula C18H28O and a molecular weight of 260.42 g/mol. Its IUPAC name is 1-tert-butyl-4-[[(1S)-2-methylcyclohexyl]methoxy]benzene.
| Compound Name | 1-tert-butyl-4-[[(1S)-2-methylcyclohexyl]methoxy]benzene |
|---|---|
| PubChem CID | 144526488 |
| Molecular Formula | C18H28O |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | 1-tert-butyl-4-[[(1S)-2-methylcyclohexyl]methoxy]benzene |
| SMILES | CC1CCCC[C@@H]1COc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H28O/c1-14-7-5-6-8-15(14)13-19-17-11-9-16(10-12-17)18(2,3)4/h9-12,14-15H,5-8,13H2,1-4H3/t14?,15-/m1/s1 |
| InChIKey | DSHRBHUWASPCJE-YSSOQSIOSA-N |
| XLogP | 5.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |