C29H24ClN3 — CID 144527338
1-(4-chlorophenyl)-2-(4-pyridin-4-ylphenyl)benzimidazole;(3Z)-penta-1,3-diene (PubChem CID 144527338) has the molecular formula C29H24ClN3 and a molecular weight of 449.99 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-(4-pyridin-4-ylphenyl)benzimidazole;(3Z)-penta-1,3-diene.
| Compound Name | 1-(4-chlorophenyl)-2-(4-pyridin-4-ylphenyl)benzimidazole;(3Z)-penta-1,3-diene |
|---|---|
| PubChem CID | 144527338 |
| Molecular Formula | C29H24ClN3 |
| Molecular Weight | 449.99 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 1-(4-chlorophenyl)-2-(4-pyridin-4-ylphenyl)benzimidazole;(3Z)-penta-1,3-diene |
| SMILES | C=C/C=C\C.Clc1ccc(-n2c(-c3ccc(-c4ccncc4)cc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C24H16ClN3.C5H8/c25-20-9-11-21(12-10-20)28-23-4-2-1-3-22(23)27-24(28)19-7-5-17(6-8-19)18-13-15-26-16-14-18;1-3-5-4-2/h1-16H;3-5H,1H2,2H3/b;5-4- |
| InChIKey | FSMGLMZIVDWQGR-GUHKXDMSSA-N |
| XLogP | 8.16 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.99 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|