C12H21N3 — CID 144527786
N'-methyl-N-[(2Z)-4-methyl-4-[(methylideneamino)methyl]hexa-2,5-dien-3-yl]ethanimidamide (PubChem CID 144527786) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is N'-methyl-N-[(2Z)-4-methyl-4-[(methylideneamino)methyl]hexa-2,5-dien-3-yl]ethanimidamide.
| Compound Name | N'-methyl-N-[(2Z)-4-methyl-4-[(methylideneamino)methyl]hexa-2,5-dien-3-yl]ethanimidamide |
|---|---|
| PubChem CID | 144527786 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | N'-methyl-N-[(2Z)-4-methyl-4-[(methylideneamino)methyl]hexa-2,5-dien-3-yl]ethanimidamide |
| SMILES | C=CC(C)(CN=C)/C(=C/C)N/C(C)=N/C |
| InChI | InChI=1S/C12H21N3/c1-7-11(15-10(3)14-6)12(4,8-2)9-13-5/h7-8H,2,5,9H2,1,3-4,6H3,(H,14,15)/b11-7- |
| InChIKey | YOACGONQQDURHV-XFFZJAGNSA-N |
| XLogP | 2.42 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|