C11H20N2 — CID 91449481
6-tert-butyl-2-propan-2-yl-1,4-dihydropyrimidine (PubChem CID 91449481) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 6-tert-butyl-2-propan-2-yl-1,4-dihydropyrimidine.
| Compound Name | 6-tert-butyl-2-propan-2-yl-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 91449481 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 6-tert-butyl-2-propan-2-yl-1,4-dihydropyrimidine |
| SMILES | CC(C)C1=NCC=C(C(C)(C)C)N1 |
| InChI | InChI=1S/C11H20N2/c1-8(2)10-12-7-6-9(13-10)11(3,4)5/h6,8H,7H2,1-5H3,(H,12,13) |
| InChIKey | UVHPVCCNLKMIFZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |